C38H54NO6+ — CID 177225018
[cyclohexyl-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] 3-methylbutanoate;methanol (PubChem CID 177225018) has the molecular formula C38H54NO6+ and a molecular weight of 620.85 g/mol. Its IUPAC name is [cyclohexyl-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] 3-methylbutanoate;methanol.
| Compound Name | [cyclohexyl-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] 3-methylbutanoate;methanol |
|---|---|
| PubChem CID | 177225018 |
| Molecular Formula | C38H54NO6+ |
| Molecular Weight | 620.85 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | [cyclohexyl-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] 3-methylbutanoate;methanol |
| SMILES | CC(C)CC(=O)OC(OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1)C1CCCCC1.CO |
| InChI | InChI=1S/C37H50NO5.CH4O/c1-27(2)24-34(39)42-35(28-14-6-3-7-15-28)43-37(29-16-8-4-9-17-29,30-18-10-5-11-19-30)36(40)41-33-25-31-20-21-32(26-33)38(31)22-12-13-23-38;1-2/h4-5,8-11,16-19,27-28,31-33,35H,3,6-7,12-15,20-26H2,1-2H3;2H,1H3/q+1; |
| InChIKey | ZVCUINFOSPKWGQ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.85 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|