C39H54NO3S+ — CID 172566684
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[cyclohexyl(cyclohexylmethylsulfanyl)methoxy]-2,2-diphenylacetate (PubChem CID 172566684) has the molecular formula C39H54NO3S+ and a molecular weight of 616.93 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[cyclohexyl(cyclohexylmethylsulfanyl)methoxy]-2,2-diphenylacetate.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[cyclohexyl(cyclohexylmethylsulfanyl)methoxy]-2,2-diphenylacetate |
|---|---|
| PubChem CID | 172566684 |
| Molecular Formula | C39H54NO3S+ |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[cyclohexyl(cyclohexylmethylsulfanyl)methoxy]-2,2-diphenylacetate |
| SMILES | O=C(OC1CC2CCC(C1)[N+]21CCCC1)C(OC(SCC1CCCCC1)C1CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H54NO3S/c41-38(42-36-27-34-23-24-35(28-36)40(34)25-13-14-26-40)39(32-19-9-3-10-20-32,33-21-11-4-12-22-33)43-37(31-17-7-2-8-18-31)44-29-30-15-5-1-6-16-30/h3-4,9-12,19-22,30-31,34-37H,1-2,5-8,13-18,23-29H2/q+1 |
| InChIKey | HCFGHKBXTTYVFL-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|