C32H42NO5+ — CID 172566592
[2-methyl-1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)propyl] propanoate (PubChem CID 172566592) has the molecular formula C32H42NO5+ and a molecular weight of 520.69 g/mol. Its IUPAC name is [2-methyl-1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)propyl] propanoate.
| Compound Name | [2-methyl-1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)propyl] propanoate |
|---|---|
| PubChem CID | 172566592 |
| Molecular Formula | C32H42NO5+ |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | [2-methyl-1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)propyl] propanoate |
| SMILES | CCC(=O)OC(OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C32H42NO5/c1-4-29(34)37-30(23(2)3)38-32(24-13-7-5-8-14-24,25-15-9-6-10-16-25)31(35)36-28-21-26-17-18-27(22-28)33(26)19-11-12-20-33/h5-10,13-16,23,26-28,30H,4,11-12,17-22H2,1-3H3/q+1 |
| InChIKey | JJHDKEWBKXEICA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|