C36H48NO7+ — CID 177226672
1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)carbonyloxyethyl octanoate (PubChem CID 177226672) has the molecular formula C36H48NO7+ and a molecular weight of 606.78 g/mol. Its IUPAC name is 1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)carbonyloxyethyl octanoate.
| Compound Name | 1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)carbonyloxyethyl octanoate |
|---|---|
| PubChem CID | 177226672 |
| Molecular Formula | C36H48NO7+ |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | 1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)carbonyloxyethyl octanoate |
| SMILES | CCCCCCCC(=O)OC(C)OC(=O)OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H48NO7/c1-3-4-5-6-13-20-33(38)41-27(2)42-35(40)44-36(28-16-9-7-10-17-28,29-18-11-8-12-19-29)34(39)43-32-25-30-21-22-31(26-32)37(30)23-14-15-24-37/h7-12,16-19,27,30-32H,3-6,13-15,20-26H2,1-2H3/q+1 |
| InChIKey | KFBSQCQVDFRPIR-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|