C39H55NO7 — CID 172567397
1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)propyl decanoate formate (PubChem CID 172567397) has the molecular formula C39H55NO7 and a molecular weight of 649.87 g/mol. Its IUPAC name is 1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)propyl decanoate formate.
| Compound Name | 1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)propyl decanoate formate |
|---|---|
| PubChem CID | 172567397 |
| Molecular Formula | C39H55NO7 |
| Molecular Weight | 649.87 g/mol |
| Exact Mass | 649.40 |
| IUPAC Name | 1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)propyl decanoate formate |
| SMILES | CCCCCCCCCC(=O)OC(CC)OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1.O=C[O-] |
| InChI | InChI=1S/C38H54NO5.CH2O2/c1-3-5-6-7-8-9-16-23-35(40)43-36(4-2)44-38(30-19-12-10-13-20-30,31-21-14-11-15-22-31)37(41)42-34-28-32-24-25-33(29-34)39(32)26-17-18-27-39;2-1-3/h10-15,19-22,32-34,36H,3-9,16-18,23-29H2,1-2H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | DDNSZPWFPKVAHJ-UHFFFAOYSA-M |
| XLogP | 6.58 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.87 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|