C31H38NO7+ — CID 172566937
4-oxo-4-[1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)ethoxy]butanoic acid (PubChem CID 172566937) has the molecular formula C31H38NO7+ and a molecular weight of 536.65 g/mol. Its IUPAC name is 4-oxo-4-[1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)ethoxy]butanoic acid.
| Compound Name | 4-oxo-4-[1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)ethoxy]butanoic acid |
|---|---|
| PubChem CID | 172566937 |
| Molecular Formula | C31H38NO7+ |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 4-oxo-4-[1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)ethoxy]butanoic acid |
| SMILES | CC(OC(=O)CCC(=O)O)OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H37NO7/c1-22(37-29(35)17-16-28(33)34)39-31(23-10-4-2-5-11-23,24-12-6-3-7-13-24)30(36)38-27-20-25-14-15-26(21-27)32(25)18-8-9-19-32/h2-7,10-13,22,25-27H,8-9,14-21H2,1H3/p+1 |
| InChIKey | KHGSCQWXPDQPST-UHFFFAOYSA-O |
| XLogP | 4.55 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|