C36H40NO7+ — CID 172567189
4-oxo-4-[(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)-phenylmethoxy]butanoic acid (PubChem CID 172567189) has the molecular formula C36H40NO7+ and a molecular weight of 598.72 g/mol. Its IUPAC name is 4-oxo-4-[(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)-phenylmethoxy]butanoic acid.
| Compound Name | 4-oxo-4-[(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)-phenylmethoxy]butanoic acid |
|---|---|
| PubChem CID | 172567189 |
| Molecular Formula | C36H40NO7+ |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 4-oxo-4-[(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)-phenylmethoxy]butanoic acid |
| SMILES | O=C(O)CCC(=O)OC(OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39NO7/c38-32(39)20-21-33(40)43-34(26-12-4-1-5-13-26)44-36(27-14-6-2-7-15-27,28-16-8-3-9-17-28)35(41)42-31-24-29-18-19-30(25-31)37(29)22-10-11-23-37/h1-9,12-17,29-31,34H,10-11,18-25H2/p+1 |
| InChIKey | IDLMAAMWXUBIDH-UHFFFAOYSA-O |
| XLogP | 5.90 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|