C32H41ClNO3+ — CID 172567314
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[chloro(cyclohexyl)methoxy]-2,2-diphenylacetate (PubChem CID 172567314) has the molecular formula C32H41ClNO3+ and a molecular weight of 523.14 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[chloro(cyclohexyl)methoxy]-2,2-diphenylacetate.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[chloro(cyclohexyl)methoxy]-2,2-diphenylacetate |
|---|---|
| PubChem CID | 172567314 |
| Molecular Formula | C32H41ClNO3+ |
| Molecular Weight | 523.14 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[chloro(cyclohexyl)methoxy]-2,2-diphenylacetate |
| SMILES | O=C(OC1CC2CCC(C1)[N+]21CCCC1)C(OC(Cl)C1CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H41ClNO3/c33-30(24-12-4-1-5-13-24)37-32(25-14-6-2-7-15-25,26-16-8-3-9-17-26)31(35)36-29-22-27-18-19-28(23-29)34(27)20-10-11-21-34/h2-3,6-9,14-17,24,27-30H,1,4-5,10-13,18-23H2/q+1 |
| InChIKey | HLCJOZZNNYQGRQ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.14 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|