C34H43NO7 — CID 172567688
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[acetyloxy(cyclopentyl)methoxy]-2,2-diphenylacetate formate (PubChem CID 172567688) has the molecular formula C34H43NO7 and a molecular weight of 577.72 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[acetyloxy(cyclopentyl)methoxy]-2,2-diphenylacetate formate.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[acetyloxy(cyclopentyl)methoxy]-2,2-diphenylacetate formate |
|---|---|
| PubChem CID | 172567688 |
| Molecular Formula | C34H43NO7 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[acetyloxy(cyclopentyl)methoxy]-2,2-diphenylacetate formate |
| SMILES | CC(=O)OC(OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1)C1CCCC1.O=C[O-] |
| InChI | InChI=1S/C33H42NO5.CH2O2/c1-24(35)37-31(25-12-8-9-13-25)39-33(26-14-4-2-5-15-26,27-16-6-3-7-17-27)32(36)38-30-22-28-18-19-29(23-30)34(28)20-10-11-21-34;2-1-3/h2-7,14-17,25,28-31H,8-13,18-23H2,1H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | IIKVYKLSSLKUTB-UHFFFAOYSA-M |
| XLogP | 4.24 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|