C37H49NO8 — CID 172566893
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[cyclopentyl(2-methylpropoxycarbonyloxy)methoxy]-2,2-diphenylacetate formate (PubChem CID 172566893) has the molecular formula C37H49NO8 and a molecular weight of 635.80 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[cyclopentyl(2-methylpropoxycarbonyloxy)methoxy]-2,2-diphenylacetate formate.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[cyclopentyl(2-methylpropoxycarbonyloxy)methoxy]-2,2-diphenylacetate formate |
|---|---|
| PubChem CID | 172566893 |
| Molecular Formula | C37H49NO8 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.35 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[cyclopentyl(2-methylpropoxycarbonyloxy)methoxy]-2,2-diphenylacetate formate |
| SMILES | CC(C)COC(=O)OC(OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1)C1CCCC1.O=C[O-] |
| InChI | InChI=1S/C36H48NO6.CH2O2/c1-26(2)25-40-35(39)42-33(27-13-9-10-14-27)43-36(28-15-5-3-6-16-28,29-17-7-4-8-18-29)34(38)41-32-23-30-19-20-31(24-32)37(30)21-11-12-22-37;2-1-3/h3-8,15-18,26-27,30-33H,9-14,19-25H2,1-2H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | XDHANLUHXFAZRS-UHFFFAOYSA-M |
| XLogP | 5.49 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|