C42H47NO5S — CID 172566953
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-[2-phenyl-1-(2-phenylethylsulfanyl)ethoxy]acetate formate (PubChem CID 172566953) has the molecular formula C42H47NO5S and a molecular weight of 677.91 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-[2-phenyl-1-(2-phenylethylsulfanyl)ethoxy]acetate formate.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-[2-phenyl-1-(2-phenylethylsulfanyl)ethoxy]acetate formate |
|---|---|
| PubChem CID | 172566953 |
| Molecular Formula | C42H47NO5S |
| Molecular Weight | 677.91 g/mol |
| Exact Mass | 677.32 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-[2-phenyl-1-(2-phenylethylsulfanyl)ethoxy]acetate formate |
| SMILES | O=C(OC1CC2CCC(C1)[N+]21CCCC1)C(OC(Cc1ccccc1)SCCc1ccccc1)(c1ccccc1)c1ccccc1.O=C[O-] |
| InChI | InChI=1S/C41H46NO3S.CH2O2/c43-40(44-38-30-36-23-24-37(31-38)42(36)26-13-14-27-42)41(34-19-9-3-10-20-34,35-21-11-4-12-22-35)45-39(29-33-17-7-2-8-18-33)46-28-25-32-15-5-1-6-16-32;2-1-3/h1-12,15-22,36-39H,13-14,23-31H2;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | MQUADCJHQXVGPZ-UHFFFAOYSA-M |
| XLogP | 6.70 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.91 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|