C31H41ClNO3+ — CID 177226479
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-(1-chlorohexoxy)-2,2-diphenylacetate (PubChem CID 177226479) has the molecular formula C31H41ClNO3+ and a molecular weight of 511.13 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-(1-chlorohexoxy)-2,2-diphenylacetate.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-(1-chlorohexoxy)-2,2-diphenylacetate |
|---|---|
| PubChem CID | 177226479 |
| Molecular Formula | C31H41ClNO3+ |
| Molecular Weight | 511.13 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-(1-chlorohexoxy)-2,2-diphenylacetate |
| SMILES | CCCCCC(Cl)OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H41ClNO3/c1-2-3-6-17-29(32)36-31(24-13-7-4-8-14-24,25-15-9-5-10-16-25)30(34)35-28-22-26-18-19-27(23-28)33(26)20-11-12-21-33/h4-5,7-10,13-16,26-29H,2-3,6,11-12,17-23H2,1H3/q+1 |
| InChIKey | ACRAFDLEQISLSS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.13 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|