C34H46ClNO5 — CID 172566690
(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl octanoate chloride (PubChem CID 172566690) has the molecular formula C34H46ClNO5 and a molecular weight of 584.20 g/mol. Its IUPAC name is (2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl octanoate chloride.
| Compound Name | (2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl octanoate chloride |
|---|---|
| PubChem CID | 172566690 |
| Molecular Formula | C34H46ClNO5 |
| Molecular Weight | 584.20 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | (2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl octanoate chloride |
| SMILES | CCCCCCCC(=O)OCOC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C34H46NO5.ClH/c1-2-3-4-5-12-19-32(36)38-26-39-34(27-15-8-6-9-16-27,28-17-10-7-11-18-28)33(37)40-31-24-29-20-21-30(25-31)35(29)22-13-14-23-35;/h6-11,15-18,29-31H,2-5,12-14,19-26H2,1H3;1H/q+1;/p-1 |
| InChIKey | DALKHACNRGLCFZ-UHFFFAOYSA-M |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.20 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|