C31H44ClNO4Si — CID 172567555
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-(2-trimethylsilylethoxymethoxy)acetate chloride (PubChem CID 172567555) has the molecular formula C31H44ClNO4Si and a molecular weight of 558.24 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-(2-trimethylsilylethoxymethoxy)acetate chloride.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-(2-trimethylsilylethoxymethoxy)acetate chloride |
|---|---|
| PubChem CID | 172567555 |
| Molecular Formula | C31H44ClNO4Si |
| Molecular Weight | 558.24 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-(2-trimethylsilylethoxymethoxy)acetate chloride |
| SMILES | C[Si](C)(C)CCOCOC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C31H44NO4Si.ClH/c1-37(2,3)21-20-34-24-35-31(25-12-6-4-7-13-25,26-14-8-5-9-15-26)30(33)36-29-22-27-16-17-28(23-29)32(27)18-10-11-19-32;/h4-9,12-15,27-29H,10-11,16-24H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | JCTKAMRGTRXGNO-UHFFFAOYSA-M |
| XLogP | 3.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|