C35H45N2O7+ — CID 177224739
4-O-(1-methylpyrrolidin-3-yl) 1-O-[(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] butanedioate (PubChem CID 177224739) has the molecular formula C35H45N2O7+ and a molecular weight of 605.75 g/mol. Its IUPAC name is 4-O-(1-methylpyrrolidin-3-yl) 1-O-[(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] butanedioate.
| Compound Name | 4-O-(1-methylpyrrolidin-3-yl) 1-O-[(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] butanedioate |
|---|---|
| PubChem CID | 177224739 |
| Molecular Formula | C35H45N2O7+ |
| Molecular Weight | 605.75 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | 4-O-(1-methylpyrrolidin-3-yl) 1-O-[(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] butanedioate |
| SMILES | CN1CCC(OC(=O)CCC(=O)OCOC(C(=O)OC2CC3CCC(C2)[N+]32CCCC2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C35H45N2O7/c1-36-19-18-30(24-36)43-33(39)17-16-32(38)41-25-42-35(26-10-4-2-5-11-26,27-12-6-3-7-13-27)34(40)44-31-22-28-14-15-29(23-31)37(28)20-8-9-21-37/h2-7,10-13,28-31H,8-9,14-25H2,1H3/q+1 |
| InChIKey | ZGTHADVSEIKLBS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.75 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|