C35H52ClNO4Si — CID 172567040
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-[tri(propan-2-yl)silyloxymethoxy]acetate chloride (PubChem CID 172567040) has the molecular formula C35H52ClNO4Si and a molecular weight of 614.34 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-[tri(propan-2-yl)silyloxymethoxy]acetate chloride.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-[tri(propan-2-yl)silyloxymethoxy]acetate chloride |
|---|---|
| PubChem CID | 172567040 |
| Molecular Formula | C35H52ClNO4Si |
| Molecular Weight | 614.34 g/mol |
| Exact Mass | 613.34 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2,2-diphenyl-2-[tri(propan-2-yl)silyloxymethoxy]acetate chloride |
| SMILES | CC(C)[Si](OCOC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1)(C(C)C)C(C)C.[Cl-] |
| InChI | InChI=1S/C35H52NO4Si.ClH/c1-26(2)41(27(3)4,28(5)6)39-25-38-35(29-15-9-7-10-16-29,30-17-11-8-12-18-30)34(37)40-33-23-31-19-20-32(24-33)36(31)21-13-14-22-36;/h7-12,15-18,26-28,31-33H,13-14,19-25H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | NCARJJBGFINWHP-UHFFFAOYSA-M |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|