C27H31N2O5+ — CID 177225819
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-(2-nitrosoacetyl)oxy-2,2-diphenylacetate (PubChem CID 177225819) has the molecular formula C27H31N2O5+ and a molecular weight of 463.55 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-(2-nitrosoacetyl)oxy-2,2-diphenylacetate.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-(2-nitrosoacetyl)oxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 177225819 |
| Molecular Formula | C27H31N2O5+ |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-(2-nitrosoacetyl)oxy-2,2-diphenylacetate |
| SMILES | O=NCC(=O)OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31N2O5/c30-25(19-28-32)34-27(20-9-3-1-4-10-20,21-11-5-2-6-12-21)26(31)33-24-17-22-13-14-23(18-24)29(22)15-7-8-16-29/h1-6,9-12,22-24H,7-8,13-19H2/q+1 |
| InChIKey | WQQZDZZTGTZKEB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|