C32H40NO7+ — CID 177224815
1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)carbonyloxyethyl butanoate (PubChem CID 177224815) has the molecular formula C32H40NO7+ and a molecular weight of 550.67 g/mol. Its IUPAC name is 1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)carbonyloxyethyl butanoate.
| Compound Name | 1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)carbonyloxyethyl butanoate |
|---|---|
| PubChem CID | 177224815 |
| Molecular Formula | C32H40NO7+ |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 1-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)carbonyloxyethyl butanoate |
| SMILES | CCCC(=O)OC(C)OC(=O)OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H40NO7/c1-3-12-29(34)37-23(2)38-31(36)40-32(24-13-6-4-7-14-24,25-15-8-5-9-16-25)30(35)39-28-21-26-17-18-27(22-28)33(26)19-10-11-20-33/h4-9,13-16,23,26-28H,3,10-12,17-22H2,1-2H3/q+1 |
| InChIKey | NVHHZCUSQLHKLK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|