C32H40ClNO5 — CID 172566658
spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[chloro(cyclopentyl)methoxy]-2,2-diphenylacetate formate (PubChem CID 172566658) has the molecular formula C32H40ClNO5 and a molecular weight of 554.13 g/mol. Its IUPAC name is spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[chloro(cyclopentyl)methoxy]-2,2-diphenylacetate formate.
| Compound Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[chloro(cyclopentyl)methoxy]-2,2-diphenylacetate formate |
|---|---|
| PubChem CID | 172566658 |
| Molecular Formula | C32H40ClNO5 |
| Molecular Weight | 554.13 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yl 2-[chloro(cyclopentyl)methoxy]-2,2-diphenylacetate formate |
| SMILES | O=C(OC1CC2CCC(C1)[N+]21CCCC1)C(OC(Cl)C1CCCC1)(c1ccccc1)c1ccccc1.O=C[O-] |
| InChI | InChI=1S/C31H39ClNO3.CH2O2/c32-29(23-11-7-8-12-23)36-31(24-13-3-1-4-14-24,25-15-5-2-6-16-25)30(34)35-28-21-26-17-18-27(22-28)33(26)19-9-10-20-33;2-1-3/h1-6,13-16,23,26-29H,7-12,17-22H2;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | PJYIVVWXIQXXPB-UHFFFAOYSA-M |
| XLogP | 4.92 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.13 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|