C36H47NO7 — CID 172566758
[cyclobutyl-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] 3-methylbutanoate formate (PubChem CID 172566758) has the molecular formula C36H47NO7 and a molecular weight of 605.77 g/mol. Its IUPAC name is [cyclobutyl-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] 3-methylbutanoate formate.
| Compound Name | [cyclobutyl-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] 3-methylbutanoate formate |
|---|---|
| PubChem CID | 172566758 |
| Molecular Formula | C36H47NO7 |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | [cyclobutyl-(2-oxo-1,1-diphenyl-2-spiro[8-azoniabicyclo[3.2.1]octane-8,1'-azolidin-1-ium]-3-yloxyethoxy)methyl] 3-methylbutanoate formate |
| SMILES | CC(C)CC(=O)OC(OC(C(=O)OC1CC2CCC(C1)[N+]21CCCC1)(c1ccccc1)c1ccccc1)C1CCC1.O=C[O-] |
| InChI | InChI=1S/C35H46NO5.CH2O2/c1-25(2)22-32(37)40-33(26-12-11-13-26)41-35(27-14-5-3-6-15-27,28-16-7-4-8-17-28)34(38)39-31-23-29-18-19-30(24-31)36(29)20-9-10-21-36;2-1-3/h3-8,14-17,25-26,29-31,33H,9-13,18-24H2,1-2H3;1H,(H,2,3)/q+1;/p-1 |
| InChIKey | FCMGDXOGADCABE-UHFFFAOYSA-M |
| XLogP | 4.88 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|