C22H27NO4 — CID 10155959
(1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate (PubChem CID 10155959) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate.
| Compound Name | (1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate |
|---|---|
| PubChem CID | 10155959 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (1-oxidopiperidin-1-ium-4-yl) 2,2-diphenyl-2-propoxyacetate |
| SMILES | CCCOC(C(=O)OC1CC[NH+]([O-])CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO4/c1-2-17-26-22(18-9-5-3-6-10-18,19-11-7-4-8-12-19)21(24)27-20-13-15-23(25)16-14-20/h3-12,20,23H,2,13-17H2,1H3 |
| InChIKey | QKDVCLZEGNZUCC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |