C22H23ClF5NO3 — CID 121267164
piperidin-4-yl 2-(2,2,3,3,3-pentafluoropropoxy)-2,2-diphenylacetate;hydrochloride (PubChem CID 121267164) has the molecular formula C22H23ClF5NO3 and a molecular weight of 479.87 g/mol. Its IUPAC name is piperidin-4-yl 2-(2,2,3,3,3-pentafluoropropoxy)-2,2-diphenylacetate;hydrochloride.
| Compound Name | piperidin-4-yl 2-(2,2,3,3,3-pentafluoropropoxy)-2,2-diphenylacetate;hydrochloride |
|---|---|
| PubChem CID | 121267164 |
| Molecular Formula | C22H23ClF5NO3 |
| Molecular Weight | 479.87 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | piperidin-4-yl 2-(2,2,3,3,3-pentafluoropropoxy)-2,2-diphenylacetate;hydrochloride |
| SMILES | Cl.O=C(OC1CCNCC1)C(OCC(F)(F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22F5NO3.ClH/c23-20(24,22(25,26)27)15-30-21(16-7-3-1-4-8-16,17-9-5-2-6-10-17)19(29)31-18-11-13-28-14-12-18;/h1-10,18,28H,11-15H2;1H |
| InChIKey | QTACSRRZSOSXDH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|