C19H28NO3+ — CID 66713267
(2R)-2-[1-[(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl]cyclopentyl]-2-hydroxy-2-phenylacetic acid (PubChem CID 66713267) has the molecular formula C19H28NO3+ and a molecular weight of 318.44 g/mol. Its IUPAC name is (2R)-2-[1-[(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl]cyclopentyl]-2-hydroxy-2-phenylacetic acid.
| Compound Name | (2R)-2-[1-[(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl]cyclopentyl]-2-hydroxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 66713267 |
| Molecular Formula | C19H28NO3+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | (2R)-2-[1-[(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl]cyclopentyl]-2-hydroxy-2-phenylacetic acid |
| SMILES | C[N+]1(C)CC[C@H](C2([C@](O)(C(=O)O)c3ccccc3)CCCC2)C1 |
| InChI | InChI=1S/C19H27NO3/c1-20(2)13-10-16(14-20)18(11-6-7-12-18)19(23,17(21)22)15-8-4-3-5-9-15/h3-5,8-9,16,23H,6-7,10-14H2,1-2H3/p+1/t16-,19+/m0/s1 |
| InChIKey | BGQADAVTHGYXGZ-QFBILLFUSA-O |
| XLogP | 2.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|