C24H26NO5+ — CID 59753967
[(4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-(hydroxymethyl)xanthene-9-carboxylate (PubChem CID 59753967) has the molecular formula C24H26NO5+ and a molecular weight of 408.47 g/mol. Its IUPAC name is [(4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-(hydroxymethyl)xanthene-9-carboxylate.
| Compound Name | [(4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-(hydroxymethyl)xanthene-9-carboxylate |
|---|---|
| PubChem CID | 59753967 |
| Molecular Formula | C24H26NO5+ |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [(4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-(hydroxymethyl)xanthene-9-carboxylate |
| SMILES | C[N+]1(C)C2CC(OC(=O)C3(CO)c4ccccc4Oc4ccccc43)C[C@H]1[C@@H]1OC21 |
| InChI | InChI=1S/C24H26NO5/c1-25(2)17-11-14(12-18(25)22-21(17)30-22)28-23(27)24(13-26)15-7-3-5-9-19(15)29-20-10-6-4-8-16(20)24/h3-10,14,17-18,21-22,26H,11-13H2,1-2H3/q+1/t14?,17-,18?,21-,22?/m0/s1 |
| InChIKey | SIVWOVIKMKRBRN-STWWVEFSSA-N |
| XLogP | 2.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|