C23H27N2O3+ — CID 10049844
[(1S,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[(2-phenylphenyl)methyl]carbamate (PubChem CID 10049844) has the molecular formula C23H27N2O3+ and a molecular weight of 379.48 g/mol. Its IUPAC name is [(1S,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[(2-phenylphenyl)methyl]carbamate.
| Compound Name | [(1S,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[(2-phenylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 10049844 |
| Molecular Formula | C23H27N2O3+ |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | [(1S,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[(2-phenylphenyl)methyl]carbamate |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)NCc3ccccc3-c3ccccc3)C[C@H]1C1OC12 |
| InChI | InChI=1S/C23H26N2O3/c1-25(2)19-12-17(13-20(25)22-21(19)28-22)27-23(26)24-14-16-10-6-7-11-18(16)15-8-4-3-5-9-15/h3-11,17,19-22H,12-14H2,1-2H3/p+1/t17?,19-,20+,21?,22? |
| InChIKey | SBWURBHCGDLDBZ-MNXYVFOMSA-O |
| XLogP | 3.34 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|