C34H38IN3O5 — CID 87138818
[(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-(4-formyl-2-methylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate iodide (PubChem CID 87138818) has the molecular formula C34H38IN3O5 and a molecular weight of 695.60 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-(4-formyl-2-methylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate iodide.
| Compound Name | [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-(4-formyl-2-methylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate iodide |
|---|---|
| PubChem CID | 87138818 |
| Molecular Formula | C34H38IN3O5 |
| Molecular Weight | 695.60 g/mol |
| Exact Mass | 695.19 |
| IUPAC Name | [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-(4-formyl-2-methylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate iodide |
| SMILES | Cc1cc(C=O)ccc1NC(=O)CCCc1ccc(-c2ccccc2)c(NC(=O)OC2C[C@@H]3[C@H]4O[C@H]4[C@H](C2)[N+]3(C)C)c1.[I-] |
| InChI | InChI=1S/C34H37N3O5.HI/c1-21-16-23(20-38)13-15-27(21)35-31(39)11-7-8-22-12-14-26(24-9-5-4-6-10-24)28(17-22)36-34(40)41-25-18-29-32-33(42-32)30(19-25)37(29,2)3;/h4-6,9-10,12-17,20,25,29-30,32-33H,7-8,11,18-19H2,1-3H3,(H-,35,36,38,39,40);1H/t25?,29-,30+,32-,33+; |
| InChIKey | LRKZKIAMOORHNT-XVNCUOKTSA-N |
| XLogP | 2.75 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|