C25H26N2O4 — CID 66597660
[5-[4-[4-(hydroxymethyl)-2-methylanilino]-4-oxobutyl]-2-phenylphenyl]carbamic acid (PubChem CID 66597660) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is [5-[4-[4-(hydroxymethyl)-2-methylanilino]-4-oxobutyl]-2-phenylphenyl]carbamic acid.
| Compound Name | [5-[4-[4-(hydroxymethyl)-2-methylanilino]-4-oxobutyl]-2-phenylphenyl]carbamic acid |
|---|---|
| PubChem CID | 66597660 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [5-[4-[4-(hydroxymethyl)-2-methylanilino]-4-oxobutyl]-2-phenylphenyl]carbamic acid |
| SMILES | Cc1cc(CO)ccc1NC(=O)CCCc1ccc(-c2ccccc2)c(NC(=O)O)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-17-14-19(16-28)11-13-22(17)26-24(29)9-5-6-18-10-12-21(20-7-3-2-4-8-20)23(15-18)27-25(30)31/h2-4,7-8,10-15,27-28H,5-6,9,16H2,1H3,(H,26,29)(H,30,31) |
| InChIKey | DLLAPFCIFRWALU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |