C21H20N2O4S — CID 66597777
[5-[3-[[5-(hydroxymethyl)thiophen-2-yl]amino]-3-oxopropyl]-2-phenylphenyl]carbamic acid (PubChem CID 66597777) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is [5-[3-[[5-(hydroxymethyl)thiophen-2-yl]amino]-3-oxopropyl]-2-phenylphenyl]carbamic acid.
| Compound Name | [5-[3-[[5-(hydroxymethyl)thiophen-2-yl]amino]-3-oxopropyl]-2-phenylphenyl]carbamic acid |
|---|---|
| PubChem CID | 66597777 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [5-[3-[[5-(hydroxymethyl)thiophen-2-yl]amino]-3-oxopropyl]-2-phenylphenyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(CCC(=O)Nc2ccc(CO)s2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C21H20N2O4S/c24-13-16-8-11-20(28-16)23-19(25)10-7-14-6-9-17(15-4-2-1-3-5-15)18(12-14)22-21(26)27/h1-6,8-9,11-12,22,24H,7,10,13H2,(H,23,25)(H,26,27) |
| InChIKey | UOJWYAQPEMRTJA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |