C30H35N3O5 — CID 90240833
[5-[4-[[5-[4-(hydroxymethyl)anilino]-5-oxopentyl]-methylamino]-4-oxobutyl]-2-phenylphenyl]carbamic acid (PubChem CID 90240833) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is [5-[4-[[5-[4-(hydroxymethyl)anilino]-5-oxopentyl]-methylamino]-4-oxobutyl]-2-phenylphenyl]carbamic acid.
| Compound Name | [5-[4-[[5-[4-(hydroxymethyl)anilino]-5-oxopentyl]-methylamino]-4-oxobutyl]-2-phenylphenyl]carbamic acid |
|---|---|
| PubChem CID | 90240833 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | [5-[4-[[5-[4-(hydroxymethyl)anilino]-5-oxopentyl]-methylamino]-4-oxobutyl]-2-phenylphenyl]carbamic acid |
| SMILES | CN(CCCCC(=O)Nc1ccc(CO)cc1)C(=O)CCCc1ccc(-c2ccccc2)c(NC(=O)O)c1 |
| InChI | InChI=1S/C30H35N3O5/c1-33(19-6-5-11-28(35)31-25-16-13-23(21-34)14-17-25)29(36)12-7-8-22-15-18-26(24-9-3-2-4-10-24)27(20-22)32-30(37)38/h2-4,9-10,13-18,20,32,34H,5-8,11-12,19,21H2,1H3,(H,31,35)(H,37,38) |
| InChIKey | YESXESNITYXOTA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|