C32H42N2O5Si — CID 66597218
[5-[5-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxyanilino]-5-oxopentyl]-2-phenylphenyl]carbamic acid (PubChem CID 66597218) has the molecular formula C32H42N2O5Si and a molecular weight of 562.78 g/mol. Its IUPAC name is [5-[5-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxyanilino]-5-oxopentyl]-2-phenylphenyl]carbamic acid.
| Compound Name | [5-[5-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxyanilino]-5-oxopentyl]-2-phenylphenyl]carbamic acid |
|---|---|
| PubChem CID | 66597218 |
| Molecular Formula | C32H42N2O5Si |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | [5-[5-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methoxyanilino]-5-oxopentyl]-2-phenylphenyl]carbamic acid |
| SMILES | COc1cc(NC(=O)CCCCc2ccc(-c3ccccc3)c(NC(=O)O)c2)ccc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H42N2O5Si/c1-32(2,3)40(5,6)39-22-25-17-18-26(21-29(25)38-4)33-30(35)15-11-10-12-23-16-19-27(24-13-8-7-9-14-24)28(20-23)34-31(36)37/h7-9,13-14,16-21,34H,10-12,15,22H2,1-6H3,(H,33,35)(H,36,37) |
| InChIKey | NGYDKXDZOBUIQO-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|