C39H51N3O5Si — CID 87066265
[(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylanilino]-4-oxobutyl]-2-phenylphenyl]carbamate (PubChem CID 87066265) has the molecular formula C39H51N3O5Si and a molecular weight of 669.94 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylanilino]-4-oxobutyl]-2-phenylphenyl]carbamate.
| Compound Name | [(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylanilino]-4-oxobutyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 87066265 |
| Molecular Formula | C39H51N3O5Si |
| Molecular Weight | 669.94 g/mol |
| Exact Mass | 669.36 |
| IUPAC Name | [(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylanilino]-4-oxobutyl]-2-phenylphenyl]carbamate |
| SMILES | Cc1cc(CO[Si](C)(C)C(C)(C)C)ccc1NC(=O)CCCc1ccc(-c2ccccc2)c(NC(=O)OC2C[C@@H]3[C@H]4O[C@H]4[C@H](C2)N3C)c1 |
| InChI | InChI=1S/C39H51N3O5Si/c1-25-20-27(24-45-48(6,7)39(2,3)4)17-19-31(25)40-35(43)15-11-12-26-16-18-30(28-13-9-8-10-14-28)32(21-26)41-38(44)46-29-22-33-36-37(47-36)34(23-29)42(33)5/h8-10,13-14,16-21,29,33-34,36-37H,11-12,15,22-24H2,1-7H3,(H,40,43)(H,41,44)/t29?,33-,34+,36-,37+ |
| InChIKey | UUHXSWOLHYUEHD-URCNPGRFSA-N |
| XLogP | 8.31 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.94 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|