C36H37N3O5 — CID 87066138
[(1S,2S,4R,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] N-[4-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate (PubChem CID 87066138) has the molecular formula C36H37N3O5 and a molecular weight of 591.71 g/mol. Its IUPAC name is [(1S,2S,4R,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] N-[4-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate.
| Compound Name | [(1S,2S,4R,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] N-[4-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 87066138 |
| Molecular Formula | C36H37N3O5 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | [(1S,2S,4R,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] N-[4-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate |
| SMILES | CN1[C@H]2CC(OC(=O)Nc3ccc(CCCC(=O)Nc4ccc5cc(CO)ccc5c4)cc3-c3ccccc3)C[C@H]1[C@H]1O[C@H]12 |
| InChI | InChI=1S/C36H37N3O5/c1-39-31-19-28(20-32(39)35-34(31)44-35)43-36(42)38-30-15-11-22(17-29(30)24-7-3-2-4-8-24)6-5-9-33(41)37-27-14-13-25-16-23(21-40)10-12-26(25)18-27/h2-4,7-8,10-18,28,31-32,34-35,40H,5-6,9,19-21H2,1H3,(H,37,41)(H,38,42)/t28?,31-,32-,34-,35+/m0/s1 |
| InChIKey | WVCIIOCBYFIYOO-WLIFSBKBSA-N |
| XLogP | 6.12 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|