C34H38N3O4+ — CID 66597802
(1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 66597802) has the molecular formula C34H38N3O4+ and a molecular weight of 552.70 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 66597802 |
| Molecular Formula | C34H38N3O4+ |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | C[N+]1(C)CCC(OC(=O)Nc2cc(CCC(=O)Nc3ccc4cc(CO)ccc4c3)ccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C34H37N3O4/c1-37(2)18-16-30(17-19-37)41-34(40)36-32-21-24(9-14-31(32)26-6-4-3-5-7-26)10-15-33(39)35-29-13-12-27-20-25(23-38)8-11-28(27)22-29/h3-9,11-14,20-22,30,38H,10,15-19,23H2,1-2H3,(H-,35,36,39,40)/p+1 |
| InChIKey | PSYAVSIDTVMOMN-UHFFFAOYSA-O |
| XLogP | 6.36 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|