C37H39IN3O5+ — CID 123279220
[(1R,2R,4S,5S,7S)-1-iodo-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate (PubChem CID 123279220) has the molecular formula C37H39IN3O5+ and a molecular weight of 732.64 g/mol. Its IUPAC name is [(1R,2R,4S,5S,7S)-1-iodo-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate.
| Compound Name | [(1R,2R,4S,5S,7S)-1-iodo-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 123279220 |
| Molecular Formula | C37H39IN3O5+ |
| Molecular Weight | 732.64 g/mol |
| Exact Mass | 732.19 |
| IUPAC Name | [(1R,2R,4S,5S,7S)-1-iodo-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate |
| SMILES | C[N+]1(C)[C@H]2C[C@H](OC(=O)Nc3cc(CCCC(=O)Nc4ccc5cc(CO)ccc5c4)ccc3-c3ccccc3)C[C@@]1(I)[C@@H]1O[C@H]12 |
| InChI | InChI=1S/C37H38IN3O5/c1-41(2)32-20-29(21-37(41,38)35-34(32)46-35)45-36(44)40-31-18-23(12-16-30(31)25-8-4-3-5-9-25)7-6-10-33(43)39-28-15-14-26-17-24(22-42)11-13-27(26)19-28/h3-5,8-9,11-19,29,32,34-35,42H,6-7,10,20-22H2,1-2H3,(H-,39,40,43,44)/p+1/t29-,32-,34-,35+,37-/m0/s1 |
| InChIKey | QAIDLQWIYWTERP-NLUBALAESA-O |
| XLogP | 7.03 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.64 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|