C32H32ClIN3O5+ — CID 123371249
[(1R,2R,4S,5S,7S)-1-iodo-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[3-(3-chloro-4-formylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 123371249) has the molecular formula C32H32ClIN3O5+ and a molecular weight of 700.98 g/mol. Its IUPAC name is [(1R,2R,4S,5S,7S)-1-iodo-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[3-(3-chloro-4-formylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | [(1R,2R,4S,5S,7S)-1-iodo-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[3-(3-chloro-4-formylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 123371249 |
| Molecular Formula | C32H32ClIN3O5+ |
| Molecular Weight | 700.98 g/mol |
| Exact Mass | 700.11 |
| IUPAC Name | [(1R,2R,4S,5S,7S)-1-iodo-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[3-(3-chloro-4-formylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | C[N+]1(C)[C@H]2C[C@H](OC(=O)Nc3cc(CCC(=O)Nc4ccc(C=O)c(Cl)c4)ccc3-c3ccccc3)C[C@@]1(I)[C@@H]1O[C@H]12 |
| InChI | InChI=1S/C32H31ClIN3O5/c1-37(2)27-16-23(17-32(37,34)30-29(27)42-30)41-31(40)36-26-14-19(8-12-24(26)20-6-4-3-5-7-20)9-13-28(39)35-22-11-10-21(18-38)25(33)15-22/h3-8,10-12,14-15,18,23,27,29-30H,9,13,16-17H2,1-2H3,(H-,35,36,38,39,40)/p+1/t23-,27-,29-,30+,32-/m0/s1 |
| InChIKey | KZZDDTPPKNUHFZ-LVCOLXGBSA-O |
| XLogP | 6.46 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.98 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|