C36H34IN3O5 — CID 141283655
(9-iodo-8,8-dimethyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-6-yl) N-[5-[3-[(6-formylnaphthalen-2-yl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 141283655) has the molecular formula C36H34IN3O5 and a molecular weight of 715.59 g/mol. Its IUPAC name is (9-iodo-8,8-dimethyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-6-yl) N-[5-[3-[(6-formylnaphthalen-2-yl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | (9-iodo-8,8-dimethyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-6-yl) N-[5-[3-[(6-formylnaphthalen-2-yl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 141283655 |
| Molecular Formula | C36H34IN3O5 |
| Molecular Weight | 715.59 g/mol |
| Exact Mass | 715.15 |
| IUPAC Name | (9-iodo-8,8-dimethyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-6-yl) N-[5-[3-[(6-formylnaphthalen-2-yl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | CC1(C)CC(OC(=O)Nc2cc(CCC(=O)Nc3ccc4cc(C=O)ccc4c3)ccc2-c2ccccc2)C2C3OC3C1N2I |
| InChI | InChI=1S/C36H34IN3O5/c1-36(2)19-29(31-32-33(45-32)34(36)40(31)37)44-35(43)39-28-17-21(9-14-27(28)23-6-4-3-5-7-23)10-15-30(42)38-26-13-12-24-16-22(20-41)8-11-25(24)18-26/h3-9,11-14,16-18,20,29,31-34H,10,15,19H2,1-2H3,(H,38,42)(H,39,43) |
| InChIKey | APCHTYQGPPQSKR-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|