C37H40N3O5+ — CID 87138774
[(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate (PubChem CID 87138774) has the molecular formula C37H40N3O5+ and a molecular weight of 606.74 g/mol. Its IUPAC name is [(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate.
| Compound Name | [(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 87138774 |
| Molecular Formula | C37H40N3O5+ |
| Molecular Weight | 606.74 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | [(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[4-[[6-(hydroxymethyl)naphthalen-2-yl]amino]-4-oxobutyl]-2-phenylphenyl]carbamate |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)Nc3cc(CCCC(=O)Nc4ccc5cc(CO)ccc5c4)ccc3-c3ccccc3)C[C@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C37H39N3O5/c1-40(2)32-20-29(21-33(40)36-35(32)45-36)44-37(43)39-31-18-23(12-16-30(31)25-8-4-3-5-9-25)7-6-10-34(42)38-28-15-14-26-17-24(22-41)11-13-27(26)19-28/h3-5,8-9,11-19,29,32-33,35-36,41H,6-7,10,20-22H2,1-2H3,(H-,38,39,42,43)/p+1/t29?,32-,33+,35-,36+ |
| InChIKey | YLNMIBSQVBUDSB-KPHRQTJLSA-O |
| XLogP | 6.27 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|