C31H37ClIN3O4 — CID 66597079
(1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[4-[3-chloro-4-(hydroxymethyl)anilino]-4-oxobutyl]-2-phenylphenyl]carbamate iodide (PubChem CID 66597079) has the molecular formula C31H37ClIN3O4 and a molecular weight of 678.01 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[4-[3-chloro-4-(hydroxymethyl)anilino]-4-oxobutyl]-2-phenylphenyl]carbamate iodide.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[4-[3-chloro-4-(hydroxymethyl)anilino]-4-oxobutyl]-2-phenylphenyl]carbamate iodide |
|---|---|
| PubChem CID | 66597079 |
| Molecular Formula | C31H37ClIN3O4 |
| Molecular Weight | 678.01 g/mol |
| Exact Mass | 677.15 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[4-[3-chloro-4-(hydroxymethyl)anilino]-4-oxobutyl]-2-phenylphenyl]carbamate iodide |
| SMILES | C[N+]1(C)CCC(OC(=O)Nc2cc(CCCC(=O)Nc3ccc(CO)c(Cl)c3)ccc2-c2ccccc2)CC1.[I-] |
| InChI | InChI=1S/C31H36ClN3O4.HI/c1-35(2)17-15-26(16-18-35)39-31(38)34-29-19-22(11-14-27(29)23-8-4-3-5-9-23)7-6-10-30(37)33-25-13-12-24(21-36)28(32)20-25;/h3-5,8-9,11-14,19-20,26,36H,6-7,10,15-18,21H2,1-2H3,(H-,33,34,37,38);1H |
| InChIKey | KJOUYPHCPQHBHJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.01 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|