C31H38N3O5+ — CID 66597083
(1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[4-(hydroxymethyl)-3-methoxyanilino]-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 66597083) has the molecular formula C31H38N3O5+ and a molecular weight of 532.66 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[4-(hydroxymethyl)-3-methoxyanilino]-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[4-(hydroxymethyl)-3-methoxyanilino]-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 66597083 |
| Molecular Formula | C31H38N3O5+ |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[4-(hydroxymethyl)-3-methoxyanilino]-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | COc1cc(NC(=O)CCc2ccc(-c3ccccc3)c(NC(=O)OC3CC[N+](C)(C)CC3)c2)ccc1CO |
| InChI | InChI=1S/C31H37N3O5/c1-34(2)17-15-26(16-18-34)39-31(37)33-28-19-22(9-13-27(28)23-7-5-4-6-8-23)10-14-30(36)32-25-12-11-24(21-35)29(20-25)38-3/h4-9,11-13,19-20,26,35H,10,14-18,21H2,1-3H3,(H-,32,33,36,37)/p+1 |
| InChIKey | YWLCZENETMLEQJ-UHFFFAOYSA-O |
| XLogP | 5.21 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|