C31H36N3O4+ — CID 87066286
(1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-(4-formyl-N-methylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 87066286) has the molecular formula C31H36N3O4+ and a molecular weight of 514.65 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-(4-formyl-N-methylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-(4-formyl-N-methylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 87066286 |
| Molecular Formula | C31H36N3O4+ |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-(4-formyl-N-methylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | CN(C(=O)CCc1ccc(-c2ccccc2)c(NC(=O)OC2CC[N+](C)(C)CC2)c1)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C31H35N3O4/c1-33(26-13-9-24(22-35)10-14-26)30(36)16-12-23-11-15-28(25-7-5-4-6-8-25)29(21-23)32-31(37)38-27-17-19-34(2,3)20-18-27/h4-11,13-15,21-22,27H,12,16-20H2,1-3H3/p+1 |
| InChIKey | IKLSKQUWSBDDGR-UHFFFAOYSA-O |
| XLogP | 5.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|