C29H33N4O4+ — CID 87066199
(1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[(5-formyl-2-pyridinyl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 87066199) has the molecular formula C29H33N4O4+ and a molecular weight of 501.61 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[(5-formyl-2-pyridinyl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[(5-formyl-2-pyridinyl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 87066199 |
| Molecular Formula | C29H33N4O4+ |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[(5-formyl-2-pyridinyl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | C[N+]1(C)CCC(OC(=O)Nc2cc(CCC(=O)Nc3ccc(C=O)cn3)ccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C29H32N4O4/c1-33(2)16-14-24(15-17-33)37-29(36)31-26-18-21(8-11-25(26)23-6-4-3-5-7-23)10-13-28(35)32-27-12-9-22(20-34)19-30-27/h3-9,11-12,18-20,24H,10,13-17H2,1-2H3,(H-,30,31,32,34,35,36)/p+1 |
| InChIKey | HHOWQMGPPMCSNX-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|