C36H36N3O5+ — CID 87066256
[(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[3-[(6-formylnaphthalen-2-yl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 87066256) has the molecular formula C36H36N3O5+ and a molecular weight of 590.70 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[3-[(6-formylnaphthalen-2-yl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[3-[(6-formylnaphthalen-2-yl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 87066256 |
| Molecular Formula | C36H36N3O5+ |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-[5-[3-[(6-formylnaphthalen-2-yl)amino]-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)Nc3cc(CCC(=O)Nc4ccc5cc(C=O)ccc5c4)ccc3-c3ccccc3)C[C@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C36H35N3O5/c1-39(2)31-19-28(20-32(39)35-34(31)44-35)43-36(42)38-30-17-22(9-14-29(30)24-6-4-3-5-7-24)10-15-33(41)37-27-13-12-25-16-23(21-40)8-11-26(25)18-27/h3-9,11-14,16-18,21,28,31-32,34-35H,10,15,19-20H2,1-2H3,(H-,37,38,40,41,42)/p+1/t28?,31-,32+,34-,35+ |
| InChIKey | QNDJCPIMCOZZTJ-FBLQAJTLSA-O |
| XLogP | 6.20 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|