C42H48N5O6+ — CID 66597379
(1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[4-[2-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 66597379) has the molecular formula C42H48N5O6+ and a molecular weight of 718.88 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[4-[2-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[4-[2-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 66597379 |
| Molecular Formula | C42H48N5O6+ |
| Molecular Weight | 718.88 g/mol |
| Exact Mass | 718.36 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) N-[5-[3-[4-[2-[[(2S)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]anilino]-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | C[N+]1(C)CCC(OC(=O)Nc2cc(CCC(=O)Nc3ccc(CCNC[C@@H](O)c4ccc(O)c5[nH]c(=O)ccc45)cc3)ccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C42H47N5O6/c1-47(2)24-21-32(22-25-47)53-42(52)45-36-26-29(10-14-33(36)30-6-4-3-5-7-30)11-18-39(50)44-31-12-8-28(9-13-31)20-23-43-27-38(49)34-15-17-37(48)41-35(34)16-19-40(51)46-41/h3-10,12-17,19,26,32,38,43,49H,11,18,20-25,27H2,1-2H3,(H3-,44,45,46,48,50,51,52)/p+1/t38-/m1/s1 |
| InChIKey | FLYJXNSCVPKIJB-KXQOOQHDSA-O |
| XLogP | 6.12 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.88 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|