C43H50N4O6 — CID 90239851
[4-(methylamino)cyclohexyl] N-[5-[4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]butyl]-2-phenylphenyl]carbamate (PubChem CID 90239851) has the molecular formula C43H50N4O6 and a molecular weight of 718.90 g/mol. Its IUPAC name is [4-(methylamino)cyclohexyl] N-[5-[4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]butyl]-2-phenylphenyl]carbamate.
| Compound Name | [4-(methylamino)cyclohexyl] N-[5-[4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]butyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 90239851 |
| Molecular Formula | C43H50N4O6 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.37 |
| IUPAC Name | [4-(methylamino)cyclohexyl] N-[5-[4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]butyl]-2-phenylphenyl]carbamate |
| SMILES | CNC1CCC(OC(=O)Nc2cc(CCCCOc3ccc(CCNC[C@H](O)c4ccc(O)c5[nH]c(=O)ccc45)cc3)ccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C43H50N4O6/c1-44-32-13-17-34(18-14-32)53-43(51)46-38-27-30(12-19-35(38)31-8-3-2-4-9-31)7-5-6-26-52-33-15-10-29(11-16-33)24-25-45-28-40(49)36-20-22-39(48)42-37(36)21-23-41(50)47-42/h2-4,8-12,15-16,19-23,27,32,34,40,44-45,48-49H,5-7,13-14,17-18,24-26,28H2,1H3,(H,46,51)(H,47,50)/t32?,34?,40-/m0/s1 |
| InChIKey | FBUVULZFDXJOIK-UPSHPWOWSA-N |
| XLogP | 7.25 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|