C36H37N3O6 — CID 90239594
[4-[4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]butyl]-2-phenylphenyl]carbamic acid (PubChem CID 90239594) has the molecular formula C36H37N3O6 and a molecular weight of 607.71 g/mol. Its IUPAC name is [4-[4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]butyl]-2-phenylphenyl]carbamic acid.
| Compound Name | [4-[4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]butyl]-2-phenylphenyl]carbamic acid |
|---|---|
| PubChem CID | 90239594 |
| Molecular Formula | C36H37N3O6 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | [4-[4-[4-[2-[[(2R)-2-hydroxy-2-(8-hydroxy-2-oxo-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]butyl]-2-phenylphenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(CCCCOc2ccc(CCNC[C@H](O)c3ccc(O)c4[nH]c(=O)ccc34)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C36H37N3O6/c40-32-17-14-28(29-15-18-34(42)39-35(29)32)33(41)23-37-20-19-24-9-12-27(13-10-24)45-21-5-4-6-25-11-16-31(38-36(43)44)30(22-25)26-7-2-1-3-8-26/h1-3,7-18,22,33,37-38,40-41H,4-6,19-21,23H2,(H,39,42)(H,43,44)/t33-/m0/s1 |
| InChIKey | MCACRJVSSUEWQF-XIFFEERXSA-N |
| XLogP | 6.26 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|