C34H38IN3O6 — CID 141283627
(9-iodo-8,8-dimethyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-6-yl) N-[5-[4-[4-(hydroxymethyl)-3-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]carbamate (PubChem CID 141283627) has the molecular formula C34H38IN3O6 and a molecular weight of 711.60 g/mol. Its IUPAC name is (9-iodo-8,8-dimethyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-6-yl) N-[5-[4-[4-(hydroxymethyl)-3-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]carbamate.
| Compound Name | (9-iodo-8,8-dimethyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-6-yl) N-[5-[4-[4-(hydroxymethyl)-3-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 141283627 |
| Molecular Formula | C34H38IN3O6 |
| Molecular Weight | 711.60 g/mol |
| Exact Mass | 711.18 |
| IUPAC Name | (9-iodo-8,8-dimethyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-6-yl) N-[5-[4-[4-(hydroxymethyl)-3-methoxyanilino]-4-oxobutyl]-2-phenylphenyl]carbamate |
| SMILES | COc1cc(NC(=O)CCCc2ccc(-c3ccccc3)c(NC(=O)OC3CC(C)(C)C4C5OC5C3N4I)c2)ccc1CO |
| InChI | InChI=1S/C34H38IN3O6/c1-34(2)18-27(29-30-31(44-30)32(34)38(29)35)43-33(41)37-25-16-20(12-15-24(25)21-9-5-4-6-10-21)8-7-11-28(40)36-23-14-13-22(19-39)26(17-23)42-3/h4-6,9-10,12-17,27,29-32,39H,7-8,11,18-19H2,1-3H3,(H,36,40)(H,37,41) |
| InChIKey | BLFYESOAXVFPBB-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.60 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|