C30H33FIN3O4 — CID 141283684
[1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[3-(3-fluoro-4-formylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 141283684) has the molecular formula C30H33FIN3O4 and a molecular weight of 645.51 g/mol. Its IUPAC name is [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[3-(3-fluoro-4-formylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[3-(3-fluoro-4-formylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 141283684 |
| Molecular Formula | C30H33FIN3O4 |
| Molecular Weight | 645.51 g/mol |
| Exact Mass | 645.15 |
| IUPAC Name | [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[3-(3-fluoro-4-formylanilino)-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | CI(C)N1CCCC(OC(=O)Nc2cc(CCC(=O)Nc3ccc(C=O)c(F)c3)ccc2-c2ccccc2)C1 |
| InChI | InChI=1S/C30H33FIN3O4/c1-32(2)35-16-6-9-25(19-35)39-30(38)34-28-17-21(10-14-26(28)22-7-4-3-5-8-22)11-15-29(37)33-24-13-12-23(20-36)27(31)18-24/h3-5,7-8,10,12-14,17-18,20,25H,6,9,11,15-16,19H2,1-2H3,(H,33,37)(H,34,38) |
| InChIKey | VZOAHVHHMPZGKI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.51 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|