C31H36IN3O4 — CID 141283613
[1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[4-[4-(4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate (PubChem CID 141283613) has the molecular formula C31H36IN3O4 and a molecular weight of 641.55 g/mol. Its IUPAC name is [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[4-[4-(4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate.
| Compound Name | [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[4-[4-(4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 141283613 |
| Molecular Formula | C31H36IN3O4 |
| Molecular Weight | 641.55 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[4-[4-(4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate |
| SMILES | CI(C)N1CCCC(OC(=O)Nc2ccc(CCCC(=O)Nc3ccc(C=O)cc3)cc2-c2ccccc2)C1 |
| InChI | InChI=1S/C31H36IN3O4/c1-32(2)35-19-7-11-27(21-35)39-31(38)34-29-18-15-23(20-28(29)25-9-4-3-5-10-25)8-6-12-30(37)33-26-16-13-24(22-36)14-17-26/h3-5,9-10,13-18,20,22,27H,6-8,11-12,19,21H2,1-2H3,(H,33,37)(H,34,38) |
| InChIKey | RCMKADDVDUJLSM-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|