C31H38IN3O4 — CID 141283610
[1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[3-[4-(hydroxymethyl)-2-methylanilino]-3-oxopropyl]-2-phenylphenyl]carbamate (PubChem CID 141283610) has the molecular formula C31H38IN3O4 and a molecular weight of 643.57 g/mol. Its IUPAC name is [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[3-[4-(hydroxymethyl)-2-methylanilino]-3-oxopropyl]-2-phenylphenyl]carbamate.
| Compound Name | [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[3-[4-(hydroxymethyl)-2-methylanilino]-3-oxopropyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 141283610 |
| Molecular Formula | C31H38IN3O4 |
| Molecular Weight | 643.57 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[3-[4-(hydroxymethyl)-2-methylanilino]-3-oxopropyl]-2-phenylphenyl]carbamate |
| SMILES | Cc1cc(CO)ccc1NC(=O)CCc1ccc(-c2ccccc2)c(NC(=O)OC2CCCN(I(C)C)C2)c1 |
| InChI | InChI=1S/C31H38IN3O4/c1-22-18-24(21-36)12-15-28(22)33-30(37)16-13-23-11-14-27(25-8-5-4-6-9-25)29(19-23)34-31(38)39-26-10-7-17-35(20-26)32(2)3/h4-6,8-9,11-12,14-15,18-19,26,36H,7,10,13,16-17,20-21H2,1-3H3,(H,33,37)(H,34,38) |
| InChIKey | WVQKQFPYBZRJRE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|