C31H35BrIN3O4 — CID 141283660
[1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[4-(2-bromo-4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate (PubChem CID 141283660) has the molecular formula C31H35BrIN3O4 and a molecular weight of 720.45 g/mol. Its IUPAC name is [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[4-(2-bromo-4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate.
| Compound Name | [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[4-(2-bromo-4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate |
|---|---|
| PubChem CID | 141283660 |
| Molecular Formula | C31H35BrIN3O4 |
| Molecular Weight | 720.45 g/mol |
| Exact Mass | 719.09 |
| IUPAC Name | [1-(dimethyl-λ3-iodanyl)piperidin-3-yl] N-[5-[4-(2-bromo-4-formylanilino)-4-oxobutyl]-2-phenylphenyl]carbamate |
| SMILES | CI(C)N1CCCC(OC(=O)Nc2cc(CCCC(=O)Nc3ccc(C=O)cc3Br)ccc2-c2ccccc2)C1 |
| InChI | InChI=1S/C31H35BrIN3O4/c1-33(2)36-17-7-11-25(20-36)40-31(39)35-29-19-22(13-15-26(29)24-9-4-3-5-10-24)8-6-12-30(38)34-28-16-14-23(21-37)18-27(28)32/h3-5,9-10,13-16,18-19,21,25H,6-8,11-12,17,20H2,1-2H3,(H,34,38)(H,35,39) |
| InChIKey | ARLGRPDVVGQZDH-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.45 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|